Chapter wise List of important questions (b) SO42- (aq) + Br – (aq) SO2 (g) + Br2 (l)

1. ATOMIC STRUCTURE (c) Cr2O72- (aq) + SO2 Cr3+ (aq) + SO42- (aq)
1. What are quantum numbers? Explain their significance. (d) Fe2+ (aq) + Cr2O72- (aq) Fe3+ (aq) + Cr3+ (aq)
2. (a) What are postulates of Bohr’s model of a hydrogen atom? (e) MnO4- (aq) + SO2 (g) Mn2+ (aq) HSO4- (aq)
(b) Write its limitations. (f) Cr2O72- (aq) + SO32- (aq) Cr3+ (aq) + SO42- (aq)
(c) Explain various series of line spectra in hydrogen atom Balance the following in basic medium by ion-electron method
using Bohr’s model. (g) MnO4- (aq) + I - (aq) MnO2 (aq) + I2 (s)
(d) Give differences between emission and absorption spectra. 26. (a) Define molarity. Calculate the molarity of NaOH in the
2. CLASSIFICATION OF ELEMENTS AND PERIODICITY IN solution prepared by dissolving 4 g. in enough water to
PROPERTIES form 250 mL of the solution.
3. What is periodic property? How the following properties (b) Calculate the molarity of sodium carbonate in a
vary in a period and in a group? (a) Atomic radius solution prepared by dissolving 5.3 g. in enough water to
(b) Electronegativity (EN) (c) Ionisation energy (IE) form 250 mL of the solution.
(d) Electron gain enthalpy (e) Metallic character (c) 4 grams of NaOH is dissolved in 250 mL of the solution.
4. Define IE1 and IE2. Why is IE2 > IE1 for a given atom? Discuss Calculate molarity.
the factors that affect IE of an element. (d) Define normality. Calculate the normality of oxalic acid
5. Write an essay on s, p, d and f block elements. solution containing 6.3 g. of H2C2O4.2H2O in 500 mL of
3. CHEMICAL BONDING AND MOLECULAR STRUCTURE solution.
6. What is hybridization? Explain different types of (e) A solution is prepared by adding 2 g. of a substance A to
hybridizations involved by‘s’ and ‘p’ orbitals. 18 g. of water. Calculate the mass percent of the solute.
7. Give the molecular orbital energy diagram of N2 and O2. (f) How many numbers of moles of glucose is present in
Calculate their bond order. Explain their magnetic nature. 540 g. of glucose?
8. Predict the shapes of the following molecules, making use (g) How many numbers of moles of CaCO3 are present in
of Valence Shell Electron Pair Repulsion (VSEPR) Theory. 200 g. of CaCO3?
(a) XeF4 (b) BrF5 (c) ClF3 and (d) H2O (h) Calculate the weight of 0.1 mole of sodium carbonate.
9. Define dipole moment. (a) Compare the dipole moment of 27. (a) A carbon compound contains 12.8 % carbon, 2.1%
NH3 molecule with that of NF3 molecule. (b) Why the BF3 hydrogen, 85.1% bromine. The molecular weight of the
molecule dipole moment is zero? (c) Why the dipole compound is 187.9. Calculate the molecular formula.
moment of BeF2 is zero? (b) A carbon compound contains 4.07% hydrogen, 24.27%
10. carbon and 71.65% chlorine. Its molar mass is 98.96 g.
(a) Explain the structure of PCl5 with hybridization What is its empirical and molecular formula?
(OR) explain the hybridization of ‘P’ in PCl5. (c) A carbon compound on analysis gives the following
(OR) explain sp3d hybridization with one example. percentage composition: Carbon-14.5%, hydrogen-1.8%,
(b) Explain the structure of SF6 by hybridization. Chlorine-64.46% and oxygen-19.24%. Calculate the
(c) Explain the structure of ethylene or ehene (C2H4). empirical formula of the compound.
(d) Explain the structure of CH4 on the basis of hybridization. (d) The empirical formula of a compound is CH2O. Its
11. (a) What is hydrogen bond? Explain the different types of molecular weight is 90. Calculate the molecular formula of
hydrogen bonds with examples. the compound.
(b) Explain coordinate covalent bond with one example. 28. What are the oxidation numbers of the underlined
12. State Fajan’s rules and give suitable examples. element in each of the following species?
13. Explain the factors favourable for the formation of cation (a) KMnO4 (b) MnO42- (c) OF2 (d) O2F2 (e) K2Cr2O7 (f) Cr2O72-
in ionic bond. (g) NaHSO4 (h) H2O2 (i) MnO4-
4. STATES OF MATTER: GASES AND LIQUIDS 29. What is disproportionation reaction? Give one example.
14. Write any four postulates of kinetic molecular theory of gases. 30. Define basicity of an acid and acidity of a base.
15. Derive Ideal gas equation. 6. THERMODYNAMICS
19. State and explain Graham’s law of diffusion. Write any two 31. State Hess’s law of constant heat summation.
of its applications. 360 cm3 methane gas diffused through a 32. Define heat capacity. Derive CP – CV = R
porous membrane in 15 minutes. Under similar 33. State (a) First law and (b) Third law of thermodynamics
conditions120 cm3 another gas diffused in 10 minutes. Find 34. Define (a) open (b) closed and (c) isolated systems
the molar mass of second gas. (d) entropy (e) Enthlapy
16. Deduce (a) Boyle’s law (b) Charle’s law (c) dalton’s law 35. What are intensive and extensive properties? Give examples.
(d) Graham’s law of diffusion from kinetic gas equation. 36. What are ‘ΔH’ conventions for exothermic and
17. Define (a) rms (b) average (c) most probable endothermic reactions?
speeds of gas molecules. Give the ratio of above speeds of 37. Enthalpy of combustion of carbon to form CO2 is – 393.5
gas molecules. kJ.mlo-1. Calculate the heat released upon formation of
20. Calculate the RMS speed at 270C of 35.2 g. CO2 from carbon and dioxygen gas.
(a) Nitrogen molecules (b) CO2 gas 7. CHEMICAL EQUILIBRIUM AND ACIDS – BASES
21. Calculate kinetic energy at 270C of 38. Derive the relation between Kp and Kc for the equilibrium
(a) 3 moles of CO2 gas (b) 5 moles of nitrogen gas reaction (a) N2 (g) + 3 H2 (g) ⇌ 2 NH3 (g)
(c) 5moles of N2 gas in calories (d) 3moles of CO2 in calories (b) 2SO2 (g)+O2(g)⇌2SO3(g) (c) PCl5(g)⇌PCl3(g)+Cl2(g)
(e) 2 moles of nitrogen 39. State Le-Chatlier’s principle. Explain the application of
(f) Calculate the ratio of kinetic energies of 3 g. of LeChatlier’s principle for the industrial synthesis of
hydrogen and 4 g. of oxygen at a given temperature. (a) ammonia by Haber’s process
22. State Dalton’s law of partial pressures. (b) sulphur trioxide by contact process
40. What is conjugate acid-base pair? Write the conjugate
23. Write van der Waal’s equation.
acid and conjugate base of each of the following :
24. What is surface tension and viscosity? Write the effect of
temperature on surface tension and viscosity. Give reason (a) OH - (b) HCO3- (c) H2O (d) NH3 (e) HSO4-
to that. 41. What is salt hydrolysis? Discuss the nature of following
5. STOICHIOMETRY salt solutions:
25. Balance the following redox equation by ion-electron (a) CH3COONa (b) NH4Cl (c) NaCl
method in acidic medium 42. Define and give one example for each of (a) Bronsted –
Lowry acid (b) Bronsted – Lowry base (c) Lewis acid
(a) MnO4- (aq) + C2O42- Mn2+ (aq) + CO2 (g)
Contact: 9490975341 Mail id: [email protected]
 (d) Lewis base (d) What is meant by dry ice? Give its applications.
43. What are homogeneous and heterogeneous equilibria? 73. (a) What is synthesis gas (water gas)? How is it prepared?
Give two examples for each. (b) What is producer gas?
44. (a) What is buffer solution? 74. (a) SiF62- is known but SiCl62- not. Explain.
(b) What is meant by ionic product of water? Give its (b) CCl4 is not dissolved in water but SiCl4 dissolves. Why?
value at room temperature. Give reason.
45. State law of mass action. 75. Define catenation.
46. Calculate the pH of 76. Name any two manmade silicates.
(a) 0.05M Ba(OH)2 (b)0.05M NaOH(c)[H+]=3.8 X 10-3 M 77. What are silicones? Give one example
(d)0.05M H2SO4 (e) 0.01 M HCl (f) 0.001 M HCl 12. ENVIRONMENTAL CHEMISTRY
(g) 0.1 M HCl (h) [OH-] = 0.05 M (i) [OH-] = 2 X 10-4 M 78. Define the terms (i)
8. HYDROGEN AND ITS COMPOUNDS
(a) COD (b) BOD (c) TLV (d) Receptor (e) Sink
47. (a) Write the any four uses of hydrogen.
(ii). Give the possible BOD values of clean and polluted water.
(b) Write few lines on the utility of hydrogen gas as fuel.
79. What is acid rain? Give its pH? Which oxides cause acid
48. Write any four oxdising and four reducing properties of H2O2.
rain? What are the harmful effects of acid rains?
49. Explain with suitable examples of the following:
80. What is green house effect? Which gases cause for it?
(a) Electron deficient hydrides
Write the adverse effects of global warming.
(b) electron precise hydrides (c) electron rich hydrides
81. Mention the harmful effects caused due to depletion of
50. Define the terms (a) Soft water (b) hard water
ozone layer.
Give the cause of hardness of water.
82. (a) Name the common components of photo chemical
51. (a) What is temporary hardness of water? How is it
smog.
removed by Clarks’ method?
(b) What is PAN? What effect is caused by it?
(b) What is permanent hardness of water? How is it
83. Explain in detail the strategies adopted in Green Chemistry
removed by (i) Calgon’s method (ii) Ion exchange method
to avoid environmental pollution.
and (iii) Synthetic resin method.
13. ORGANIC CHEMISTRY
9. s – BLOCK ELEMENTS
84. Explain (a) Chain isomerism (b) Position isomerism
52. Write is Plaster of Paris? Write a short note on it.
(c) Functional group isomerism (d) Metamerism with
53. Discuss various reactions that occur in Solvay process in
one example for each.
the preparation of Na2CO3.
85. Write any two preparation methods and two chemical
54. Give the biological importance of sodium, potassium,
properties of ethane.
magnesium and calcium ions.
86. Write any two preparation methods of ethylene. How does
55. Give the reactions that take place at anode and cathode in
ethylene react with (a) Hydrogen (b) Bromine (c) Ozone
Castner – Kelllner process.
(d) Cold and alk. KMnO4 (e) HBr (f) H2SO4 (g) Cl2
56. Why is gypsum added to cement?
87. Write any two preparation methods of acetylene. How
57. Write the properties of washing soda.
does acetylene react with (a) water (b) hydrogen
58. Write any two uses of (a) Caustic soda (b) Quick lime
(c) Bromine (d) HBr (e) halogens
59. (a) Why are IA group elements called as ‘alkali metals’?
88. Write any two preparation methods of benzene. Explain
(b) Why are alkali metals not found in a free state in nature?
the following benzene reactions. (a) Halogenation
(c) Which alkali metal shows abnormal density? What is the
(b) Alkylation (c) Acylation (d) Nitration (e) Sulphonation
order of the variation of density among IA group elements?
89. Write the following reactions with equations.
(d) Why is KO2 paramagnetic?
(a) Wurtz reaction (b) Kolbe’s electrolytic method
60. (a) Which is called milk of magnesia? Give its use.
(c) Decarboxylation (d) Friedel-Craft’s reactions
(b) What happens when magnesium metal burnt in air?
(e) Polymerization of ethylene
61. (a) Lithium salts are mostly hydrated. Why? Give one example.
90. How is benzene prepared form
(b) Lithium reacts with water less vigorously than sodium.
(a) acetylene (b) nitro benzene (c) Methyl benzene
Give reason.
91. How is acetylene prepared from the following compounds:
10. p – BLOCK ELEMTNS - GROUP 13 (BORON FAMILY)
(a) calcium carbide (b) 1,2-dibromoethane
62. Explain the structure of diborane.
92. Write a short note on (a) Distillation (b) Chromatography
63. Write the preparation methods diborane? How does it
93. How is nitro benzene prepared from benzene?
react with ammonia? Give equation.
94. An alkyne ‘A’ undergoes cyclic polymerization by passing
64. What is Borax? Explain Borax bead test with a suitable
through red hot iron tube to give ‘B’. What are A and B?
example.
95. Complete the followingreactions and name A, B, C D.
65. What are electron deficient compounds? Explain why BF3 =>? CDE FG EGHI JDKJ.=L?MNJDKJ.=>O?P
acts as a Lewis acid? i. CaC2 @AB A @AAAAAAAB B > C
M>MQMMM R
66. Give the formula of borazine. What is its common name? ii. Ethylene ---Br2/CCl4-----> D
67. Define inert pair effect. 96. What is the type of hybridization of each carbon in the
11. p – BLOCK ELEMTNS - GROUP 14 (CARBON FAMILY) following compound? HC≡C-CH=CH2
68. Explain the differences in properties of diamond and 97. Draw the cis-trans isomers for the following compounds.
graphite on the basis of their structure or hybridization. (a) CHCl=CHCl (b) C2H5CH3C=CCH3C2H5
69. Explain reasons for the following: 98. Write the structures of the following compounds:
(a) Graphite is a lubricant (a) 3,3,4,5-Tetramethylheptane (b) 2-Methylpent-1-ene
(b) Diamond is an abrasive (c) 2,3-Dimethlbutane (d) 2-Methylbut-1-ene
(c) Graphite is good conductor (e) Trichloroethanoicacid (f) Neopentane
(d) Diamond has high melting point (g) 3,4,,4,5-Tetramethylheptane
(e) Diamond is hard 99. What is the IUPAC name of the following:
70. Why is carbon monoxide (CO) poisonous? (a) CH3-CH2-CH2-CH=CH2 (b) CH2=CH-CH=CH2
71. (i) What is allotropy? Name crystalline allotropes of carbon (c) CH3-CH2-CO-CH3 (d) CH3-CH2-CH2-CO-CH3
and mention the hybridization of carbon present in them. (e) CH3-CH2-CO-CH2-CH3 (f) CH3-CH(CH3)-CH(CH3)-CHO
(ii) Give hybridization of carbon in (g) CH3-C(CH3)2-CH2-C(CH3)2-CH3 (h) CH3-CH(OH)-CH2-CH2-CH3
(a) CO32- (b) CO2 (c) Diamond (d) Graphite (e) Fullerene (i)CH3-C(CH3)2-CH(CH3)-CH2-CH3 (j)CH3-C(CH3)2-CH2-CH2-COOH
72. (a) Give the use of CO2 in photosynthesis. (k) CH3-CH=C(CH3)2 (l)HO-CH2-CH2-CH2-CH(CH3)-CH(CH3)-CH3
(b) Write any four uses of CO2.
(c) Write any two uses of zeolites.
Contact: 9490975341 Mail id: [email protected]