Jump to content

Calcium tartrate: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi
reverted unexplained deletions by 103.206.138.27
 
(23 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| Watchedfields = changed
| verifiedrevid = 399703325
| verifiedrevid = 399704354
| Name = Calcium tartrate
| ImageFile = Calcium tartrate.png
| Name = Calcium tartrate
| ImageFile = Calcium L-tartrate Structural Formula V1.svg
| ImageSize = 200px
| ImageName =
| ImageSize = 200px
| ImageName =
| IUPACName = 2,3-Dihydroxybutanedioic acid calcium salt
| IUPACName = 2,3-Dihydroxybutanedioic acid calcium salt
| Section1 = {{Chembox Identifiers
| Section1 = {{Chembox Identifiers
| SMILES = [Ca+2].O=C([O-])C(O)C(O)C([O-])=O
| SMILES = [Ca+2].O=C([O-])C(O)C(O)C([O-])=O
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10606089
| ChemSpiderID = 10606089
| InChI = 1/C4H6O6.Ca/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2
| InChI = 1/C4H6O6.Ca/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2
Line 16: Line 17:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GUPPESBEIQALOS-UHFFFAOYSA-L
| StdInChIKey = GUPPESBEIQALOS-UHFFFAOYSA-L
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 3164-34-9
| CASNo = 3164-34-9
| CASOther = &nbsp;(anhydrous)<br />5892-21-7] (tetrahydrate)
| CASNo_Comment = (anhydrous)
| RTECS =
| CASNo2 = 5892-21-7
| CASNo2_Comment = (tetrahydrate)
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = O6I5B26XA7
| UNII_Comment = (anhydrous)
| RTECS =
| PubChem = 13725892
| EC_number = 221-621-5
}}
}}
| Section2 = {{Chembox Properties
| Section2 = {{Chembox Properties
| Formula = CaC<sub>4</sub>H<sub>4</sub>O<sub>6</sub>
| Formula = CaC<sub>4</sub>H<sub>4</sub>O<sub>6</sub>
| MolarMass = 188.15 g/mol (anhydrous)<br /> 260.21 g/mol (tetrahydrate)
| MolarMass = 190.16484 g/mol (anhydrous)<br /> 260.21 g/mol (tetrahydrate)
| Appearance = [[hygroscopic]] white powder<br /> or colorless crystals
| Appearance = [[hygroscopic]] white powder<br /> or colorless crystals
| Density = 1.817 g/cm<sup>3</sup> (tetrahydrate)
| Density = 1.817 g/cm<sup>3</sup> (tetrahydrate)
| Solubility = 0.037 g/100 ml (0 °C)
| Solubility = 0.037 g/100 ml (0 °C) 0.2 g/100 ml (85 °C)
| MeltingPt = tetrahydrate decomposes at 160 °C<br /> anhydrous decomposes at 650 °C
| MeltingPt = tetrahydrate decomposes at 160 °C<br /> anhydrous decomposes at 650 °C
}}
}}
| Section3 = {{Chembox Structure
| Section3 = {{Chembox Structure
| CrystalStruct = ''d'' or ''l'' [[rhombic]]<br /> ''dl'' [[triclinic]]
| CrystalStruct = ''d'' or ''l'' [[rhombic crystal system|rhombic]]<br /> ''dl'' [[triclinic]]
}}
}}
| Section7 = {{Chembox Hazards
| Section7 = {{Chembox Hazards
| ExternalMSDS = [http://www.sciencelab.com/xMSDS-L_Calcium_Tartrate_Hydrate-9923279#search=%22MSDS%20calcium%20tartrate%22 Calcium tartrate]
| ExternalSDS = [http://www.sciencelab.com/xMSDS-L_Calcium_Tartrate_Hydrate-9923279#search=%22MSDS%20calcium%20tartrate%22 Calcium tartrate]
| MainHazards =
| MainHazards =
| RPhrases =
| SPhrases =
}}
}}
}}
}}


'''Calcium tartrate''' is a byproduct of the [[wine]] industry, prepared from wine [[Ethanol fermentation|fermentation]] dregs. It is the [[calcium]] [[salt (chemistry)|salt]] of [[tartaric acid]], an acid most commonly found in ripe [[grape]]s. Its [[solubility]] decreases with colder temperature, which results in the forming of whitish (in red wine often reddish) crystalline clusters as it precipitates. It finds use as a [[food preservative]] and [[acidity regulator]]. Like [[tartaric acid]], calcium tartrate has two asymmetric carbons, hence it has two [[Chirality (chemistry)|chiral]] [[isomer]]s and a non-chiral isomer (meso-form). Most calcium tartrate of biological origin is the chiral levorotatory (–) isomer.
'''Calcium tartrate''', exactly '''calcium <small>L</small>-tartrate''', is a byproduct of the [[wine]] industry, prepared from wine [[Ethanol fermentation|fermentation]] dregs.<ref>{{Cite book|last1=Zoecklein|first1=Bruce|url=https://books.google.com/books?id=yQLyBwAAQBAJ&dq=%22Calcium+tartrate%22&pg=PA228|title=Wine Analysis and Production|last2=Fugelsang|first2=Kenneth C.|last3=Gump|first3=Barry H.|last4=Nury|first4=Fred S.|date=2013-11-09|publisher=Springer Science & Business Media|isbn=978-1-4757-6967-8|pages=228|language=en}}</ref><ref>{{Cite book|last1=Roeber|first1=Eugene Franz|url=https://books.google.com/books?id=t2NNAAAAYAAJ&dq=%22Calcium+tartrate%22&pg=PA616|title=Metallurgical & Chemical Engineering|last2=Parmelee|first2=Howard Coon|date=1915|publisher=Electrochemical Publishing Company|pages=616|language=en}}</ref><ref>{{Cite book|last1=Ribéreau-Gayon|first1=Pascal|url=https://books.google.com/books?id=a03C-aFy2jsC&dq=%22Calcium+tartrate%22&pg=PA40|title=Handbook of Enology, Volume 2: The Chemistry of Wine - Stabilization and Treatments|last2=Glories|first2=Yves|last3=Maujean|first3=Alain|last4=Dubourdieu|first4=Denis|date=2006-05-01|publisher=John Wiley & Sons|isbn=978-0-470-01038-9|pages=39–40|language=en}}</ref> It is the [[calcium]] [[salt (chemistry)|salt]] of <small>L</small>-[[tartaric acid]], an acid most commonly found in [[grape]]s.<ref>{{cite web | url = https://drugs.ncats.io/substance/O6I5B26XA7 | title = Calcium tartrate | work = InXight Drugs | publisher = National Center for Advancing Translational Sciences }}</ref> Its [[solubility]] decreases with lower temperature, which results in the forming of whitish (in red wine often reddish) crystalline clusters as it precipitates. As [[E number]] '''E354''', it finds use as a [[food preservative]] and [[acidity regulator]]. Like [[tartaric acid]], calcium tartrate has two asymmetric carbons, hence it has two [[Chirality (chemistry)|chiral]] [[isomer]]s and a non-chiral isomer (meso-form). Most calcium tartrate of biological origin is the chiral levorotatory (–) isomer.


==References==
==References==
{{Unreferenced|date =September 2007}}
<references/>
<references/>


Line 48: Line 54:
[[Category:Tartrates]]
[[Category:Tartrates]]
[[Category:Preservatives]]
[[Category:Preservatives]]
[[Category:E-number additives]]




{{organic-compound-stub}}
{{organic-compound-stub}}

[[ar:طرطرات الكالسيوم]]
[[es:Tartrato de calcio]]
[[hu:Kalcium-tartarát]]